C31H50N2O7Si — CID 158655950
methyl 9-[[5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethyl-N-methylanilino]-2,5-dioxopentyl]amino]-6,9-dioxononanoate (PubChem CID 158655950) has the molecular formula C31H50N2O7Si and a molecular weight of 590.83 g/mol. Its IUPAC name is methyl 9-[[5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethyl-N-methylanilino]-2,5-dioxopentyl]amino]-6,9-dioxononanoate.
| Compound Name | methyl 9-[[5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethyl-N-methylanilino]-2,5-dioxopentyl]amino]-6,9-dioxononanoate |
|---|---|
| PubChem CID | 158655950 |
| Molecular Formula | C31H50N2O7Si |
| Molecular Weight | 590.83 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | methyl 9-[[5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethyl-N-methylanilino]-2,5-dioxopentyl]amino]-6,9-dioxononanoate |
| SMILES | CCc1cc(CO[Si](C)(C)C(C)(C)C)cc(N(C)C(=O)CCC(=O)CNC(=O)CCC(=O)CCCCC(=O)OC)c1 |
| InChI | InChI=1S/C31H50N2O7Si/c1-9-23-18-24(22-40-41(7,8)31(2,3)4)20-25(19-23)33(5)29(37)17-15-27(35)21-32-28(36)16-14-26(34)12-10-11-13-30(38)39-6/h18-20H,9-17,21-22H2,1-8H3,(H,32,36) |
| InChIKey | BHAMAXFKPWQRCU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.83 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|