C39H46F6N5O8- — CID 158656113
[6-oxo-7-[4-[[[4-[[4-(pentylcarbamoylamino)phenyl]methylcarbamoyl]benzoyl]amino]methyl]phenyl]heptyl]azanium;bis(2,2,2-trifluoroacetate) (PubChem CID 158656113) has the molecular formula C39H46F6N5O8- and a molecular weight of 826.81 g/mol. Its IUPAC name is [6-oxo-7-[4-[[[4-[[4-(pentylcarbamoylamino)phenyl]methylcarbamoyl]benzoyl]amino]methyl]phenyl]heptyl]azanium;bis(2,2,2-trifluoroacetate).
| Compound Name | [6-oxo-7-[4-[[[4-[[4-(pentylcarbamoylamino)phenyl]methylcarbamoyl]benzoyl]amino]methyl]phenyl]heptyl]azanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 158656113 |
| Molecular Formula | C39H46F6N5O8- |
| Molecular Weight | 826.81 g/mol |
| Exact Mass | 826.33 |
| IUPAC Name | [6-oxo-7-[4-[[[4-[[4-(pentylcarbamoylamino)phenyl]methylcarbamoyl]benzoyl]amino]methyl]phenyl]heptyl]azanium;bis(2,2,2-trifluoroacetate) |
| SMILES | CCCCCNC(=O)Nc1ccc(CNC(=O)c2ccc(C(=O)NCc3ccc(CC(=O)CCCCC[NH3+])cc3)cc2)cc1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C35H45N5O4.2C2HF3O2/c1-2-3-7-22-37-35(44)40-31-19-13-28(14-20-31)25-39-34(43)30-17-15-29(16-18-30)33(42)38-24-27-11-9-26(10-12-27)23-32(41)8-5-4-6-21-36;2*3-2(4,5)1(6)7/h9-20H,2-8,21-25,36H2,1H3,(H,38,42)(H,39,43)(H2,37,40,44);2*(H,6,7)/p-1 |
| InChIKey | KEMWGQIFIDJOIZ-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 224.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.81 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|