C27H30N6O12 — CID 158656496
3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone (PubChem CID 158656496) has the molecular formula C27H30N6O12 and a molecular weight of 630.57 g/mol. Its IUPAC name is 3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone.
| Compound Name | 3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone |
|---|---|
| PubChem CID | 158656496 |
| Molecular Formula | C27H30N6O12 |
| Molecular Weight | 630.57 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone |
| SMILES | O=C1COC(=O)CNC(=O)COC(=O)C(Cc2ccc(Cn3cccn3)cc2)NC(=O)COC(=O)CNC(=O)COC(=O)CN1 |
| InChI | InChI=1S/C27H30N6O12/c34-20-13-43-25(39)10-30-22(36)15-45-27(41)19(8-17-2-4-18(5-3-17)12-33-7-1-6-31-33)32-23(37)16-44-26(40)11-29-21(35)14-42-24(38)9-28-20/h1-7,19H,8-16H2,(H,28,34)(H,29,35)(H,30,36)(H,32,37) |
| InChIKey | ICEXTCCSQVQENU-UHFFFAOYSA-N |
| XLogP | -3.51 |
| TPSA | 239.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.57 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|