About 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane
3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane (PubChem CID 158657073) has the molecular formula C13H24OSi
and a molecular weight of 224.42 g/mol. Its IUPAC name is 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane.
Molecular Properties
| Compound Name | 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane |
| PubChem CID | 158657073 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane |
| SMILES | C#CC(C)(C)OC(C)(C)C#C.C[SiH](C)C |
| InChI | InChI=1S/C10H14O.C3H10Si/c1-7-9(3,4)11-10(5,6)8-2;1-4(2)3/h1-2H,3-6H3;4H,1-3H3 |
| InChIKey | ICGUTCYMHHXXDL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane?
The IUPAC name of 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane (CID 158657073) is 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane.
What is the SMILES notation for 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane?
The canonical SMILES for 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane is C#CC(C)(C)OC(C)(C)C#C.C[SiH](C)C.
What is the InChIKey of 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane?
The InChIKey is ICGUTCYMHHXXDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C3H10Si/c1-7-9(3,4)11-10(5,6)8-2;1-4(2)3/h1-2H,3-6H3;4H,1-3H3.
What are the key properties of 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane?
3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane has a molecular weight of 224.42 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-(2-methylbut-3-yn-2-yloxy)but-1-yne;trimethylsilane is sourced from PubChem (CID 158657073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).