C34H58Cr — CID 15865787
chromium(2+);bis(1,2,3,5-tetra(propan-2-yl)cyclopenta-1,3-diene) (PubChem CID 15865787) has the molecular formula C34H58Cr and a molecular weight of 518.83 g/mol. Its IUPAC name is chromium(2+);bis(1,2,3,5-tetra(propan-2-yl)cyclopenta-1,3-diene).
| Compound Name | chromium(2+);bis(1,2,3,5-tetra(propan-2-yl)cyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 15865787 |
| Molecular Formula | C34H58Cr |
| Molecular Weight | 518.83 g/mol |
| Exact Mass | 518.39 |
| IUPAC Name | chromium(2+);bis(1,2,3,5-tetra(propan-2-yl)cyclopenta-1,3-diene) |
| SMILES | CC(C)c1c[c-](C(C)C)c(C(C)C)c1C(C)C.CC(C)c1c[c-](C(C)C)c(C(C)C)c1C(C)C.[Cr+2] |
| InChI | InChI=1S/2C17H29.Cr/c2*1-10(2)14-9-15(11(3)4)17(13(7)8)16(14)12(5)6;/h2*9-13H,1-8H3;/q2*-1;+2 |
| InChIKey | FTKLBNMYEFCDTG-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.83 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|