About 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine
2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine (PubChem CID 158657975) has the molecular formula C12H15I3N4O
and a molecular weight of 611.99 g/mol. Its IUPAC name is 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine.
Molecular Properties
| Compound Name | 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine |
| PubChem CID | 158657975 |
| Molecular Formula | C12H15I3N4O |
| Molecular Weight | 611.99 g/mol |
| Exact Mass | 611.84 |
| IUPAC Name | 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine |
| SMILES | COc1ccc(N)c(I)n1.Cc1ccc(N)cn1.II |
| InChI | InChI=1S/C6H7IN2O.C6H8N2.I2/c1-10-5-3-2-4(8)6(7)9-5;1-5-2-3-6(7)4-8-5;1-2/h2-3H,8H2,1H3;2-4H,7H2,1H3; |
| InChIKey | ICJSJTSAYLXMHX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 611.99 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine?
The IUPAC name of 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine (CID 158657975) is 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine.
What is the SMILES notation for 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine?
The canonical SMILES for 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine is COc1ccc(N)c(I)n1.Cc1ccc(N)cn1.II.
What is the InChIKey of 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine?
The InChIKey is ICJSJTSAYLXMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7IN2O.C6H8N2.I2/c1-10-5-3-2-4(8)6(7)9-5;1-5-2-3-6(7)4-8-5;1-2/h2-3H,8H2,1H3;2-4H,7H2,1H3;.
What are the key properties of 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine?
2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine has a molecular weight of 611.99 g/mol, XLogP of 4.02, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-6-methoxypyridin-3-amine;6-methylpyridin-3-amine;molecular iodine is sourced from PubChem (CID 158657975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).