C32H35IO2P2 — CID 15865947
[(4R,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-iodo-methyl-diphenyl-λ5-phosphane (PubChem CID 15865947) has the molecular formula C32H35IO2P2 and a molecular weight of 640.48 g/mol. Its IUPAC name is [(4R,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-iodo-methyl-diphenyl-λ5-phosphane.
| Compound Name | [(4R,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-iodo-methyl-diphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 15865947 |
| Molecular Formula | C32H35IO2P2 |
| Molecular Weight | 640.48 g/mol |
| Exact Mass | 640.12 |
| IUPAC Name | [(4R,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-iodo-methyl-diphenyl-λ5-phosphane |
| SMILES | CC1(C)O[C@@H](CP(c2ccccc2)c2ccccc2)[C@H](CP(C)(I)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C32H35IO2P2/c1-32(2)34-30(24-36(26-16-8-4-9-17-26)27-18-10-5-11-19-27)31(35-32)25-37(3,33,28-20-12-6-13-21-28)29-22-14-7-15-23-29/h4-23,30-31H,24-25H2,1-3H3/t30-,31-/m0/s1 |
| InChIKey | NZCSRANDAIEXCG-CONSDPRKSA-N |
| XLogP | 6.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|