About 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane
5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane (PubChem CID 158659767) has the molecular formula C13H17NO5
and a molecular weight of 267.28 g/mol. Its IUPAC name is 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane.
Molecular Properties
| Compound Name | 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane |
| PubChem CID | 158659767 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane |
| SMILES | CC1(C)CC(=O)OC1(O)c1ccccc1.C[N+](=O)[O-] |
| InChI | InChI=1S/C12H14O3.CH3NO2/c1-11(2)8-10(13)15-12(11,14)9-6-4-3-5-7-9;1-2(3)4/h3-7,14H,8H2,1-2H3;1H3 |
| InChIKey | ICPMFLLBFLWJQO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane?
The IUPAC name of 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane (CID 158659767) is 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane.
What is the SMILES notation for 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane?
The canonical SMILES for 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane is CC1(C)CC(=O)OC1(O)c1ccccc1.C[N+](=O)[O-].
What is the InChIKey of 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane?
The InChIKey is ICPMFLLBFLWJQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3.CH3NO2/c1-11(2)8-10(13)15-12(11,14)9-6-4-3-5-7-9;1-2(3)4/h3-7,14H,8H2,1-2H3;1H3.
What are the key properties of 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane?
5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane has a molecular weight of 267.28 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-4,4-dimethyl-5-phenyloxolan-2-one;nitromethane is sourced from PubChem (CID 158659767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).