C21H20O4 — CID 158660915
methane;1,3,7,9-tetramethylchromeno[4,3-c]chromene-5,11-dione (PubChem CID 158660915) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is methane;1,3,7,9-tetramethylchromeno[4,3-c]chromene-5,11-dione.
| Compound Name | methane;1,3,7,9-tetramethylchromeno[4,3-c]chromene-5,11-dione |
|---|---|
| PubChem CID | 158660915 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | methane;1,3,7,9-tetramethylchromeno[4,3-c]chromene-5,11-dione |
| SMILES | C.Cc1cc(C)c2oc(=O)c3c4cc(C)cc(C)c4oc(=O)c3c2c1 |
| InChI | InChI=1S/C20H16O4.CH4/c1-9-5-11(3)17-13(7-9)15-16(20(22)23-17)14-8-10(2)6-12(4)18(14)24-19(15)21;/h5-8H,1-4H3;1H4 |
| InChIKey | ICTBIVWEQFMMTJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|