About benzyl isoindole-2-carboxylate
benzyl isoindole-2-carboxylate (PubChem CID 15866180) has the molecular formula C16H13NO2
and a molecular weight of 251.28 g/mol. Its IUPAC name is benzyl isoindole-2-carboxylate.
Molecular Properties
| Compound Name | benzyl isoindole-2-carboxylate |
| PubChem CID | 15866180 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | benzyl isoindole-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)n1cc2ccccc2c1 |
| InChI | InChI=1S/C16H13NO2/c18-16(19-12-13-6-2-1-3-7-13)17-10-14-8-4-5-9-15(14)11-17/h1-11H,12H2 |
| InChIKey | PNWVFOPGMLSBHU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl isoindole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl isoindole-2-carboxylate?
The IUPAC name of benzyl isoindole-2-carboxylate (CID 15866180) is benzyl isoindole-2-carboxylate.
What is the SMILES notation for benzyl isoindole-2-carboxylate?
The canonical SMILES for benzyl isoindole-2-carboxylate is O=C(OCc1ccccc1)n1cc2ccccc2c1.
What is the InChIKey of benzyl isoindole-2-carboxylate?
The InChIKey is PNWVFOPGMLSBHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2/c18-16(19-12-13-6-2-1-3-7-13)17-10-14-8-4-5-9-15(14)11-17/h1-11H,12H2.
What are the key properties of benzyl isoindole-2-carboxylate?
benzyl isoindole-2-carboxylate has a molecular weight of 251.28 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl isoindole-2-carboxylate is sourced from PubChem (CID 15866180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).