About methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine
methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine (PubChem CID 158662446) has the molecular formula C10H25ClN4O4S2
and a molecular weight of 364.92 g/mol. Its IUPAC name is methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine.
Molecular Properties
| Compound Name | methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine |
| PubChem CID | 158662446 |
| Molecular Formula | C10H25ClN4O4S2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine |
| SMILES | C1CNCCN1.CS(=O)(=O)Cl.CS(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C5H12N2O2S.C4H10N2.CH3ClO2S/c1-10(8,9)7-4-2-6-3-5-7;1-2-6-4-3-5-1;1-5(2,3)4/h6H,2-5H2,1H3;5-6H,1-4H2;1H3 |
| InChIKey | ICXPVIFXWOQXMO-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine?
The IUPAC name of methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine (CID 158662446) is methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine.
What is the SMILES notation for methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine?
The canonical SMILES for methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine is C1CNCCN1.CS(=O)(=O)Cl.CS(=O)(=O)N1CCNCC1.
What is the InChIKey of methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine?
The InChIKey is ICXPVIFXWOQXMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2S.C4H10N2.CH3ClO2S/c1-10(8,9)7-4-2-6-3-5-7;1-2-6-4-3-5-1;1-5(2,3)4/h6H,2-5H2,1H3;5-6H,1-4H2;1H3.
What are the key properties of methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine?
methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine has a molecular weight of 364.92 g/mol, XLogP of -1.78, 1 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonyl chloride;1-methylsulfonylpiperazine;piperazine is sourced from PubChem (CID 158662446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).