C9H19N5 — CID 158662739
3-N,5-N,5-N,3-tetramethyl-2H-pyridine-2,3,5,6-tetramine (PubChem CID 158662739) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is 3-N,5-N,5-N,3-tetramethyl-2H-pyridine-2,3,5,6-tetramine.
| Compound Name | 3-N,5-N,5-N,3-tetramethyl-2H-pyridine-2,3,5,6-tetramine |
|---|---|
| PubChem CID | 158662739 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 3-N,5-N,5-N,3-tetramethyl-2H-pyridine-2,3,5,6-tetramine |
| SMILES | CNC1(C)C=C(N(C)C)C(N)=NC1N |
| InChI | InChI=1S/C9H19N5/c1-9(12-2)5-6(14(3)4)7(10)13-8(9)11/h5,8,12H,11H2,1-4H3,(H2,10,13) |
| InChIKey | ICYPMNXUQDYCLV-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |