C11H15NO6 — CID 158662750
but-2-enedioic acid;1-morpholin-4-ylprop-2-en-1-one (PubChem CID 158662750) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is but-2-enedioic acid;1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | but-2-enedioic acid;1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 158662750 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | but-2-enedioic acid;1-morpholin-4-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCOCC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C7H11NO2.C4H4O4/c1-2-7(9)8-3-5-10-6-4-8;5-3(6)1-2-4(7)8/h2H,1,3-6H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | ICYQCZLLJIGVRN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|