About sodium;acetic acid;carbanide
sodium;acetic acid;carbanide (PubChem CID 158665006) has the molecular formula C3H7NaO2
and a molecular weight of 98.08 g/mol. Its IUPAC name is sodium;acetic acid;carbanide.
Molecular Properties
| Compound Name | sodium;acetic acid;carbanide |
| PubChem CID | 158665006 |
| Molecular Formula | C3H7NaO2 |
| Molecular Weight | 98.08 g/mol |
| Exact Mass | 98.03 |
| IUPAC Name | sodium;acetic acid;carbanide |
| SMILES | CC(=O)O.[CH3-].[Na+] |
| InChI | InChI=1S/C2H4O2.CH3.Na/c1-2(3)4;;/h1H3,(H,3,4);1H3;/q;-1;+1 |
| InChIKey | WMGPDWKWRUNCLL-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.08 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;acetic acid;carbanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;acetic acid;carbanide?
The IUPAC name of sodium;acetic acid;carbanide (CID 158665006) is sodium;acetic acid;carbanide.
What is the SMILES notation for sodium;acetic acid;carbanide?
The canonical SMILES for sodium;acetic acid;carbanide is CC(=O)O.[CH3-].[Na+].
What is the InChIKey of sodium;acetic acid;carbanide?
The InChIKey is WMGPDWKWRUNCLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.CH3.Na/c1-2(3)4;;/h1H3,(H,3,4);1H3;/q;-1;+1.
What are the key properties of sodium;acetic acid;carbanide?
sodium;acetic acid;carbanide has a molecular weight of 98.08 g/mol, XLogP of -2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;acetic acid;carbanide is sourced from PubChem (CID 158665006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).