C24H12ClF6N7O3S2 — CID 158665464
5-[4-chloro-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-2-yl]-1,2-oxazole;N-[(3-nitrophenyl)methyl]-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 158665464) has the molecular formula C24H12ClF6N7O3S2 and a molecular weight of 659.98 g/mol. Its IUPAC name is 5-[4-chloro-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-2-yl]-1,2-oxazole;N-[(3-nitrophenyl)methyl]-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 5-[4-chloro-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-2-yl]-1,2-oxazole;N-[(3-nitrophenyl)methyl]-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 158665464 |
| Molecular Formula | C24H12ClF6N7O3S2 |
| Molecular Weight | 659.98 g/mol |
| Exact Mass | 659.00 |
| IUPAC Name | 5-[4-chloro-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-2-yl]-1,2-oxazole;N-[(3-nitrophenyl)methyl]-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | FC(F)(F)c1cc2c(Cl)nc(-c3ccno3)nc2s1.O=[N+]([O-])c1cccc(CNc2ncc3cc(C(F)(F)F)sc3n2)c1 |
| InChI | InChI=1S/C14H9F3N4O2S.C10H3ClF3N3OS/c15-14(16,17)11-5-9-7-19-13(20-12(9)24-11)18-6-8-2-1-3-10(4-8)21(22)23;11-7-4-3-6(10(12,13)14)19-9(4)17-8(16-7)5-1-2-15-18-5/h1-5,7H,6H2,(H,18,19,20);1-3H |
| InChIKey | IDHHGZNUNIPJCN-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.98 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|