C32H54O2Si2 — CID 15866596
tert-butyl-[[3-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4,5,6,7-tetrahydro-1H-inden-1-yl]ethyl]-4,5,6,7-tetrahydro-3H-inden-1-yl]oxy]-dimethylsilane (PubChem CID 15866596) has the molecular formula C32H54O2Si2 and a molecular weight of 526.95 g/mol. Its IUPAC name is tert-butyl-[[3-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4,5,6,7-tetrahydro-1H-inden-1-yl]ethyl]-4,5,6,7-tetrahydro-3H-inden-1-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[3-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4,5,6,7-tetrahydro-1H-inden-1-yl]ethyl]-4,5,6,7-tetrahydro-3H-inden-1-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 15866596 |
| Molecular Formula | C32H54O2Si2 |
| Molecular Weight | 526.95 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | tert-butyl-[[3-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4,5,6,7-tetrahydro-1H-inden-1-yl]ethyl]-4,5,6,7-tetrahydro-3H-inden-1-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC(CCC2C=C(O[Si](C)(C)C(C)(C)C)C3=C2CCCC3)C2=C1CCCC2 |
| InChI | InChI=1S/C32H54O2Si2/c1-31(2,3)35(7,8)33-29-21-23(25-15-11-13-17-27(25)29)19-20-24-22-30(28-18-14-12-16-26(24)28)34-36(9,10)32(4,5)6/h21-24H,11-20H2,1-10H3 |
| InChIKey | DFWJPVBHDFGFSG-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.95 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|