About 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane
1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane (PubChem CID 158667132) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane.
Molecular Properties
| Compound Name | 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane |
| PubChem CID | 158667132 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane |
| SMILES | C=C1CCC1.OCC1(O)CCC1 |
| InChI | InChI=1S/C5H10O2.C5H8/c6-4-5(7)2-1-3-5;1-5-3-2-4-5/h6-7H,1-4H2;1-4H2 |
| InChIKey | IDMOXCGNTBSGIH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane?
The IUPAC name of 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane (CID 158667132) is 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane.
What is the SMILES notation for 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane?
The canonical SMILES for 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane is C=C1CCC1.OCC1(O)CCC1.
What is the InChIKey of 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane?
The InChIKey is IDMOXCGNTBSGIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C5H8/c6-4-5(7)2-1-3-5;1-5-3-2-4-5/h6-7H,1-4H2;1-4H2.
What are the key properties of 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane?
1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane has a molecular weight of 170.25 g/mol, XLogP of 1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(hydroxymethyl)cyclobutan-1-ol;methylidenecyclobutane is sourced from PubChem (CID 158667132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).