C18H17N2+ — CID 158668468
4,12-dimethyl-8-phenyl-3-aza-1-azoniatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 158668468) has the molecular formula C18H17N2+ and a molecular weight of 261.35 g/mol. Its IUPAC name is 4,12-dimethyl-8-phenyl-3-aza-1-azoniatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,12-dimethyl-8-phenyl-3-aza-1-azoniatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 158668468 |
| Molecular Formula | C18H17N2+ |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4,12-dimethyl-8-phenyl-3-aza-1-azoniatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=[N+]2Cn3c(C)ccc3C(c3ccccc3)=C2C=C1 |
| InChI | InChI=1S/C18H17N2/c1-13-8-10-16-18(15-6-4-3-5-7-15)17-11-9-14(2)20(17)12-19(13)16/h3-11H,12H2,1-2H3/q+1 |
| InChIKey | MLLGDKXPXJAMOO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|