C55H46Br4O2Si — CID 158668805
4-bromo-9,9-dimethylxanthene;(3-bromophenyl)-[(9,9-dimethylxanthen-4-yl)methyl]-diphenylsilane;1,3-dibromobenzene (PubChem CID 158668805) has the molecular formula C55H46Br4O2Si and a molecular weight of 1086.67 g/mol. Its IUPAC name is 4-bromo-9,9-dimethylxanthene;(3-bromophenyl)-[(9,9-dimethylxanthen-4-yl)methyl]-diphenylsilane;1,3-dibromobenzene.
| Compound Name | 4-bromo-9,9-dimethylxanthene;(3-bromophenyl)-[(9,9-dimethylxanthen-4-yl)methyl]-diphenylsilane;1,3-dibromobenzene |
|---|---|
| PubChem CID | 158668805 |
| Molecular Formula | C55H46Br4O2Si |
| Molecular Weight | 1086.67 g/mol |
| Exact Mass | 1082.00 |
| IUPAC Name | 4-bromo-9,9-dimethylxanthene;(3-bromophenyl)-[(9,9-dimethylxanthen-4-yl)methyl]-diphenylsilane;1,3-dibromobenzene |
| SMILES | Brc1cccc(Br)c1.CC1(C)c2ccccc2Oc2c(Br)cccc21.CC1(C)c2ccccc2Oc2c(C[Si](c3ccccc3)(c3ccccc3)c3cccc(Br)c3)cccc21 |
| InChI | InChI=1S/C34H29BrOSi.C15H13BrO.C6H4Br2/c1-34(2)30-20-9-10-22-32(30)36-33-25(13-11-21-31(33)34)24-37(27-15-5-3-6-16-27,28-17-7-4-8-18-28)29-19-12-14-26(35)23-29;1-15(2)10-6-3-4-9-13(10)17-14-11(15)7-5-8-12(14)16;7-5-2-1-3-6(8)4-5/h3-23H,24H2,1-2H3;3-9H,1-2H3;1-4H |
| InChIKey | IDRSCMMRLPCSLX-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1086.67 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|