C19H37BSn — CID 15867015
but-1-ynyl-[(E)-4-dimethylstannanyliumyl-2-methylhex-3-en-3-yl]-di(propan-2-yl)boranuide (PubChem CID 15867015) has the molecular formula C19H37BSn and a molecular weight of 395.03 g/mol. Its IUPAC name is but-1-ynyl-[(E)-4-dimethylstannanyliumyl-2-methylhex-3-en-3-yl]-di(propan-2-yl)boranuide.
| Compound Name | but-1-ynyl-[(E)-4-dimethylstannanyliumyl-2-methylhex-3-en-3-yl]-di(propan-2-yl)boranuide |
|---|---|
| PubChem CID | 15867015 |
| Molecular Formula | C19H37BSn |
| Molecular Weight | 395.03 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | but-1-ynyl-[(E)-4-dimethylstannanyliumyl-2-methylhex-3-en-3-yl]-di(propan-2-yl)boranuide |
| SMILES | CCC#C[B-](/C(=C(/CC)[Sn+](C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H31B.2CH3.Sn/c1-9-11-13-18(15(5)6,16(7)8)17(12-10-2)14(3)4;;;/h14-16H,9-10H2,1-8H3;2*1H3;/q-1;;;+1 |
| InChIKey | INHBNEHIHQKOOS-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.03 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|