C27H39B2N7O6S — CID 158670935
ethyl N-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamothioyl]carbamate;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 158670935) has the molecular formula C27H39B2N7O6S and a molecular weight of 611.34 g/mol. Its IUPAC name is ethyl N-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamothioyl]carbamate;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | ethyl N-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamothioyl]carbamate;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 158670935 |
| Molecular Formula | C27H39B2N7O6S |
| Molecular Weight | 611.34 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | ethyl N-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamothioyl]carbamate;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CC1(C)OB(c2cccc3nc(N)nn23)OC1(C)C.CCOC(=O)NC(=S)Nc1cccc(B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C15H22BN3O4S.C12H17BN4O2/c1-6-21-13(20)19-12(24)18-11-9-7-8-10(17-11)16-22-14(2,3)15(4,5)23-16;1-11(2)12(3,4)19-13(18-11)8-6-5-7-9-15-10(14)16-17(8)9/h7-9H,6H2,1-5H3,(H2,17,18,19,20,24);5-7H,1-4H3,(H2,14,16) |
| InChIKey | IDYBQGSMLIGOIZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|