About tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile
tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile (PubChem CID 158671455) has the molecular formula C28H37FN4O4
and a molecular weight of 512.63 g/mol. Its IUPAC name is tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile.
Molecular Properties
| Compound Name | tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile |
| PubChem CID | 158671455 |
| Molecular Formula | C28H37FN4O4 |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile |
| SMILES | CC(C)(C)OC(=O)CN.Cc1ccc(F)c(C#N)c1.Cc1ccc(NCC(=O)OC(C)(C)C)c(C#N)c1 |
| InChI | InChI=1S/C14H18N2O2.C8H6FN.C6H13NO2/c1-10-5-6-12(11(7-10)8-15)16-9-13(17)18-14(2,3)4;1-6-2-3-8(9)7(4-6)5-10;1-6(2,3)9-5(8)4-7/h5-7,16H,9H2,1-4H3;2-4H,1H3;4,7H2,1-3H3 |
| InChIKey | IDZUPOITPWSBHI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile?
The IUPAC name of tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile (CID 158671455) is tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile.
What is the SMILES notation for tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile?
The canonical SMILES for tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile is CC(C)(C)OC(=O)CN.Cc1ccc(F)c(C#N)c1.Cc1ccc(NCC(=O)OC(C)(C)C)c(C#N)c1.
What is the InChIKey of tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile?
The InChIKey is IDZUPOITPWSBHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2.C8H6FN.C6H13NO2/c1-10-5-6-12(11(7-10)8-15)16-9-13(17)18-14(2,3)4;1-6-2-3-8(9)7(4-6)5-10;1-6(2,3)9-5(8)4-7/h5-7,16H,9H2,1-4H3;2-4H,1H3;4,7H2,1-3H3.
What are the key properties of tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile?
tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile has a molecular weight of 512.63 g/mol, XLogP of 4.91, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-aminoacetate;tert-butyl 2-(2-cyano-4-methylanilino)acetate;2-fluoro-5-methylbenzonitrile is sourced from PubChem (CID 158671455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).