C13H26OSi2 — CID 15867171
(Z)-1,5-bis(trimethylsilyl)hept-5-en-1-yn-3-ol (PubChem CID 15867171) has the molecular formula C13H26OSi2 and a molecular weight of 254.52 g/mol. Its IUPAC name is (Z)-1,5-bis(trimethylsilyl)hept-5-en-1-yn-3-ol.
| Compound Name | (Z)-1,5-bis(trimethylsilyl)hept-5-en-1-yn-3-ol |
|---|---|
| PubChem CID | 15867171 |
| Molecular Formula | C13H26OSi2 |
| Molecular Weight | 254.52 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (Z)-1,5-bis(trimethylsilyl)hept-5-en-1-yn-3-ol |
| SMILES | C/C=C(/CC(O)C#C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi2/c1-8-13(16(5,6)7)11-12(14)9-10-15(2,3)4/h8,12,14H,11H2,1-7H3/b13-8- |
| InChIKey | FEMUVVXNBLLKON-JYRVWZFOSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|