About 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide
3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide (PubChem CID 158671777) has the molecular formula C22H23BrN2O3
and a molecular weight of 443.34 g/mol. Its IUPAC name is 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide.
Molecular Properties
| Compound Name | 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide |
| PubChem CID | 158671777 |
| Molecular Formula | C22H23BrN2O3 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide |
| SMILES | CCc1ccc2c(c1)c(OC)c(C)c(N)[n+]2CC(=O)C(=O)c1ccccc1.[Br-] |
| InChI | InChI=1S/C22H22N2O3.BrH/c1-4-15-10-11-18-17(12-15)21(27-3)14(2)22(23)24(18)13-19(25)20(26)16-8-6-5-7-9-16;/h5-12,23H,4,13H2,1-3H3;1H |
| InChIKey | IEAPKSLWNNRZPJ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide?
The IUPAC name of 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide (CID 158671777) is 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide.
What is the SMILES notation for 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide?
The canonical SMILES for 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide is CCc1ccc2c(c1)c(OC)c(C)c(N)[n+]2CC(=O)C(=O)c1ccccc1.[Br-].
What is the InChIKey of 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide?
The InChIKey is IEAPKSLWNNRZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O3.BrH/c1-4-15-10-11-18-17(12-15)21(27-3)14(2)22(23)24(18)13-19(25)20(26)16-8-6-5-7-9-16;/h5-12,23H,4,13H2,1-3H3;1H.
What are the key properties of 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide?
3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide has a molecular weight of 443.34 g/mol, XLogP of 0.04, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-6-ethyl-4-methoxy-3-methylquinolin-1-ium-1-yl)-1-phenylpropane-1,2-dione bromide is sourced from PubChem (CID 158671777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).