C20H34O3 — CID 15867197
1-[(2R,3R,3aS)-3-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-2-yl]ethanone (PubChem CID 15867197) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 1-[(2R,3R,3aS)-3-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-2-yl]ethanone.
| Compound Name | 1-[(2R,3R,3aS)-3-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-2-yl]ethanone |
|---|---|
| PubChem CID | 15867197 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 1-[(2R,3R,3aS)-3-hydroxy-3-(3-hydroxy-3-methylpent-4-enyl)-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-2-yl]ethanone |
| SMILES | C=CC(C)(O)CC[C@@]1(O)[C@H](C(C)=O)CC2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C20H34O3/c1-7-18(5,22)11-12-20(23)15(14(2)21)13-16-17(3,4)9-8-10-19(16,20)6/h7,15-16,22-23H,1,8-13H2,2-6H3/t15-,16?,18?,19-,20+/m0/s1 |
| InChIKey | VQMZRHKDFCRTRN-PZABILJISA-N |
| XLogP | 3.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|