C21H28F6N2O4S2+2 — CID 158672049
1-butyl-4-methyl-2,3-bis(trifluoromethylsulfonyl)pyridin-1-ium;4-methyl-1-propylpyridin-1-ium (PubChem CID 158672049) has the molecular formula C21H28F6N2O4S2+2 and a molecular weight of 550.59 g/mol. Its IUPAC name is 1-butyl-4-methyl-2,3-bis(trifluoromethylsulfonyl)pyridin-1-ium;4-methyl-1-propylpyridin-1-ium.
| Compound Name | 1-butyl-4-methyl-2,3-bis(trifluoromethylsulfonyl)pyridin-1-ium;4-methyl-1-propylpyridin-1-ium |
|---|---|
| PubChem CID | 158672049 |
| Molecular Formula | C21H28F6N2O4S2+2 |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 1-butyl-4-methyl-2,3-bis(trifluoromethylsulfonyl)pyridin-1-ium;4-methyl-1-propylpyridin-1-ium |
| SMILES | CCCC[n+]1ccc(C)c(S(=O)(=O)C(F)(F)F)c1S(=O)(=O)C(F)(F)F.CCC[n+]1ccc(C)cc1 |
| InChI | InChI=1S/C12H14F6NO4S2.C9H14N/c1-3-4-6-19-7-5-8(2)9(24(20,21)11(13,14)15)10(19)25(22,23)12(16,17)18;1-3-6-10-7-4-9(2)5-8-10/h5,7H,3-4,6H2,1-2H3;4-5,7-8H,3,6H2,1-2H3/q2*+1 |
| InChIKey | IEBKOLAGJRUBHN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|