C19H30N6O4S — CID 15867228
3-[(1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]propanoic acid (PubChem CID 15867228) has the molecular formula C19H30N6O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-[(1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]propanoic acid.
| Compound Name | 3-[(1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 15867228 |
| Molecular Formula | C19H30N6O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 3-[(1S,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]propanoic acid |
| SMILES | CCCCNc1nc(SCCC)nc2c1nnn2[C@@H]1C[C@H](CCC(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H30N6O4S/c1-3-5-8-20-17-14-18(22-19(21-17)30-9-4-2)25(24-23-14)12-10-11(6-7-13(26)27)15(28)16(12)29/h11-12,15-16,28-29H,3-10H2,1-2H3,(H,26,27)(H,20,21,22)/t11-,12+,15+,16-/m0/s1 |
| InChIKey | DCEQWIAAHVJFQR-OJDYBEQGSA-N |
| XLogP | 2.08 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|