C34H57BrN4O12 — CID 158673007
diethyl 2-(4-cyanobutylamino)butanedioate;diethyl 2-[4-cyanobutyl-(2-ethoxy-2-oxoethyl)amino]butanedioate;ethyl 2-bromoacetate (PubChem CID 158673007) has the molecular formula C34H57BrN4O12 and a molecular weight of 793.75 g/mol. Its IUPAC name is diethyl 2-(4-cyanobutylamino)butanedioate;diethyl 2-[4-cyanobutyl-(2-ethoxy-2-oxoethyl)amino]butanedioate;ethyl 2-bromoacetate.
| Compound Name | diethyl 2-(4-cyanobutylamino)butanedioate;diethyl 2-[4-cyanobutyl-(2-ethoxy-2-oxoethyl)amino]butanedioate;ethyl 2-bromoacetate |
|---|---|
| PubChem CID | 158673007 |
| Molecular Formula | C34H57BrN4O12 |
| Molecular Weight | 793.75 g/mol |
| Exact Mass | 792.32 |
| IUPAC Name | diethyl 2-(4-cyanobutylamino)butanedioate;diethyl 2-[4-cyanobutyl-(2-ethoxy-2-oxoethyl)amino]butanedioate;ethyl 2-bromoacetate |
| SMILES | CCOC(=O)CBr.CCOC(=O)CC(C(=O)OCC)N(CCCCC#N)CC(=O)OCC.CCOC(=O)CC(NCCCCC#N)C(=O)OCC |
| InChI | InChI=1S/C17H28N2O6.C13H22N2O4.C4H7BrO2/c1-4-23-15(20)12-14(17(22)25-6-3)19(11-9-7-8-10-18)13-16(21)24-5-2;1-3-18-12(16)10-11(13(17)19-4-2)15-9-7-5-6-8-14;1-2-7-4(6)3-5/h14H,4-9,11-13H2,1-3H3;11,15H,3-7,9-10H2,1-2H3;2-3H2,1H3 |
| InChIKey | IEEHPNBUANNBTK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 220.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|