C20H34N2O2S2 — CID 158673154
2-methoxy-N',N'-bis(pentylsulfanylmethyl)benzohydrazide (PubChem CID 158673154) has the molecular formula C20H34N2O2S2 and a molecular weight of 398.64 g/mol. Its IUPAC name is 2-methoxy-N',N'-bis(pentylsulfanylmethyl)benzohydrazide.
| Compound Name | 2-methoxy-N',N'-bis(pentylsulfanylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 158673154 |
| Molecular Formula | C20H34N2O2S2 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-methoxy-N',N'-bis(pentylsulfanylmethyl)benzohydrazide |
| SMILES | CCCCCSCN(CSCCCCC)NC(=O)c1ccccc1OC |
| InChI | InChI=1S/C20H34N2O2S2/c1-4-6-10-14-25-16-22(17-26-15-11-7-5-2)21-20(23)18-12-8-9-13-19(18)24-3/h8-9,12-13H,4-7,10-11,14-17H2,1-3H3,(H,21,23) |
| InChIKey | IEESWVVYNQONHD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|