About tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate
tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate (PubChem CID 158673486) has the molecular formula C23H44N4O6
and a molecular weight of 472.63 g/mol. Its IUPAC name is tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate |
| PubChem CID | 158673486 |
| Molecular Formula | C23H44N4O6 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.CCOC(=O)CCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H26N2O4.C9H18N2O2/c1-5-19-12(17)6-7-15-8-10-16(11-9-15)13(18)20-14(2,3)4;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h5-11H2,1-4H3;10H,4-7H2,1-3H3 |
| InChIKey | IEFRQYHIQVGEIN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate (CID 158673486) is tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCNCC1.CCOC(=O)CCN1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
The InChIKey is IEFRQYHIQVGEIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O4.C9H18N2O2/c1-5-19-12(17)6-7-15-8-10-16(11-9-15)13(18)20-14(2,3)4;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h5-11H2,1-4H3;10H,4-7H2,1-3H3.
What are the key properties of tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate has a molecular weight of 472.63 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(3-ethoxy-3-oxopropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate is sourced from PubChem (CID 158673486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).