About ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol
ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol (PubChem CID 158675061) has the molecular formula C22H27I2O7+
and a molecular weight of 657.26 g/mol. Its IUPAC name is ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol.
Molecular Properties
| Compound Name | ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol |
| PubChem CID | 158675061 |
| Molecular Formula | C22H27I2O7+ |
| Molecular Weight | 657.26 g/mol |
| Exact Mass | 656.98 |
| IUPAC Name | ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc(I)cc1.Oc1ccc(I)cc1.[CH2+]COC(=O)[C@H](C)O |
| InChI | InChI=1S/C11H13IO3.C6H5IO.C5H9O3/c1-3-14-11(13)8(2)15-10-6-4-9(12)5-7-10;7-5-1-3-6(8)4-2-5;1-3-8-5(7)4(2)6/h4-8H,3H2,1-2H3;1-4,8H;4,6H,1,3H2,2H3/q;;+1/t8-;;4-/m1.0/s1 |
| InChIKey | IEKIBUPADLUOLW-NPYKCPQHSA-N |
| XLogP | 4.36 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 657.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol?
The IUPAC name of ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol (CID 158675061) is ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol.
What is the SMILES notation for ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol?
The canonical SMILES for ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol is CCOC(=O)[C@@H](C)Oc1ccc(I)cc1.Oc1ccc(I)cc1.[CH2+]COC(=O)[C@H](C)O.
What is the InChIKey of ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol?
The InChIKey is IEKIBUPADLUOLW-NPYKCPQHSA-N. The full InChI is InChI=1S/C11H13IO3.C6H5IO.C5H9O3/c1-3-14-11(13)8(2)15-10-6-4-9(12)5-7-10;7-5-1-3-6(8)4-2-5;1-3-8-5(7)4(2)6/h4-8H,3H2,1-2H3;1-4,8H;4,6H,1,3H2,2H3/q;;+1/t8-;;4-/m1.0/s1.
What are the key properties of ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol?
ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol has a molecular weight of 657.26 g/mol, XLogP of 4.36, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-hydroxypropanoate;ethyl (2R)-2-(4-iodophenoxy)propanoate;4-iodophenol is sourced from PubChem (CID 158675061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).