About 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride
3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride (PubChem CID 158676118) has the molecular formula C14H23Cl3O4S
and a molecular weight of 393.76 g/mol. Its IUPAC name is 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride.
Molecular Properties
| Compound Name | 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride |
| PubChem CID | 158676118 |
| Molecular Formula | C14H23Cl3O4S |
| Molecular Weight | 393.76 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride |
| SMILES | CC1(CCC(=O)Cl)CC1.CC1(CCC(=O)O)CC1.O=S(Cl)Cl |
| InChI | InChI=1S/C7H11ClO.C7H12O2.Cl2OS/c2*1-7(4-5-7)3-2-6(8)9;1-4(2)3/h2-5H2,1H3;2-5H2,1H3,(H,8,9); |
| InChIKey | IENUGRXBFJLURX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.76 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride?
The IUPAC name of 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride (CID 158676118) is 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride.
What is the SMILES notation for 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride?
The canonical SMILES for 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride is CC1(CCC(=O)Cl)CC1.CC1(CCC(=O)O)CC1.O=S(Cl)Cl.
What is the InChIKey of 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride?
The InChIKey is IENUGRXBFJLURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClO.C7H12O2.Cl2OS/c2*1-7(4-5-7)3-2-6(8)9;1-4(2)3/h2-5H2,1H3;2-5H2,1H3,(H,8,9);.
What are the key properties of 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride?
3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride has a molecular weight of 393.76 g/mol, XLogP of 5.03, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methylcyclopropyl)propanoic acid;3-(1-methylcyclopropyl)propanoyl chloride;thionyl dichloride is sourced from PubChem (CID 158676118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).