About 1-butyl-4-methyl-2H-pyridine;fluoroform
1-butyl-4-methyl-2H-pyridine;fluoroform (PubChem CID 158677793) has the molecular formula C11H18F3N
and a molecular weight of 221.27 g/mol. Its IUPAC name is 1-butyl-4-methyl-2H-pyridine;fluoroform.
Molecular Properties
| Compound Name | 1-butyl-4-methyl-2H-pyridine;fluoroform |
| PubChem CID | 158677793 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-butyl-4-methyl-2H-pyridine;fluoroform |
| SMILES | CCCCN1C=CC(C)=CC1.FC(F)F |
| InChI | InChI=1S/C10H17N.CHF3/c1-3-4-7-11-8-5-10(2)6-9-11;2-1(3)4/h5-6,8H,3-4,7,9H2,1-2H3;1H |
| InChIKey | IESVWESMDKFOBZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-4-methyl-2H-pyridine;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-methyl-2H-pyridine;fluoroform?
The IUPAC name of 1-butyl-4-methyl-2H-pyridine;fluoroform (CID 158677793) is 1-butyl-4-methyl-2H-pyridine;fluoroform.
What is the SMILES notation for 1-butyl-4-methyl-2H-pyridine;fluoroform?
The canonical SMILES for 1-butyl-4-methyl-2H-pyridine;fluoroform is CCCCN1C=CC(C)=CC1.FC(F)F.
What is the InChIKey of 1-butyl-4-methyl-2H-pyridine;fluoroform?
The InChIKey is IESVWESMDKFOBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.CHF3/c1-3-4-7-11-8-5-10(2)6-9-11;2-1(3)4/h5-6,8H,3-4,7,9H2,1-2H3;1H.
What are the key properties of 1-butyl-4-methyl-2H-pyridine;fluoroform?
1-butyl-4-methyl-2H-pyridine;fluoroform has a molecular weight of 221.27 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-methyl-2H-pyridine;fluoroform is sourced from PubChem (CID 158677793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).