C39H76O4SSi2 — CID 15867799
methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-pentylcyclopenten-1-yl]sulfanylhexanoate (PubChem CID 15867799) has the molecular formula C39H76O4SSi2 and a molecular weight of 697.27 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-pentylcyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-pentylcyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 15867799 |
| Molecular Formula | C39H76O4SSi2 |
| Molecular Weight | 697.27 g/mol |
| Exact Mass | 696.50 |
| IUPAC Name | methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-pentylcyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCCCC1=C(SCCCCCC(=O)OC)[C@@H](/C=C/[C@H](C[C@H](C)CCCC)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C39H76O4SSi2/c1-15-17-20-24-32-30-35(43-46(13,14)39(7,8)9)34(37(32)44-28-22-19-21-25-36(40)41-10)27-26-33(29-31(3)23-18-16-2)42-45(11,12)38(4,5)6/h26-27,31,33-35H,15-25,28-30H2,1-14H3/b27-26+/t31-,33-,34+,35-/m1/s1 |
| InChIKey | SCCNFTOYSDPZEO-HVSKSQPISA-N |
| XLogP | 12.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.27 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|