About carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate
carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate (PubChem CID 158678757) has the molecular formula C16H18N2O5
and a molecular weight of 318.33 g/mol. Its IUPAC name is carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate.
Molecular Properties
| Compound Name | carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate |
| PubChem CID | 158678757 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CC3CNC(=O)C2(C)C3)cc1.O=C=O |
| InChI | InChI=1S/C15H18N2O3.CO2/c1-15-7-10(8-16-14(15)19)9-17(15)12-5-3-11(4-6-12)13(18)20-2;2-1-3/h3-6,10H,7-9H2,1-2H3,(H,16,19); |
| InChIKey | IEVTVGSZSCBVFE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate?
The IUPAC name of carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate (CID 158678757) is carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate.
What is the SMILES notation for carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate?
The canonical SMILES for carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate is COC(=O)c1ccc(N2CC3CNC(=O)C2(C)C3)cc1.O=C=O.
What is the InChIKey of carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate?
The InChIKey is IEVTVGSZSCBVFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3.CO2/c1-15-7-10(8-16-14(15)19)9-17(15)12-5-3-11(4-6-12)13(18)20-2;2-1-3/h3-6,10H,7-9H2,1-2H3,(H,16,19);.
What are the key properties of carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate?
carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate has a molecular weight of 318.33 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;methyl 4-(5-methyl-4-oxo-3,6-diazabicyclo[3.2.1]octan-6-yl)benzoate is sourced from PubChem (CID 158678757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).