C32H49NO8 — CID 158679783
methyl 5-acetyloxy-4-oxo-5-[(3S,14R,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]pentanoate (PubChem CID 158679783) has the molecular formula C32H49NO8 and a molecular weight of 575.74 g/mol. Its IUPAC name is methyl 5-acetyloxy-4-oxo-5-[(3S,14R,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]pentanoate.
| Compound Name | methyl 5-acetyloxy-4-oxo-5-[(3S,14R,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]pentanoate |
|---|---|
| PubChem CID | 158679783 |
| Molecular Formula | C32H49NO8 |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.35 |
| IUPAC Name | methyl 5-acetyloxy-4-oxo-5-[(3S,14R,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]pentanoate |
| SMILES | COC(=O)CCC(=O)C(OC(C)=O)[C@@H]1CCCCC=CCCCC[C@H](C)C(=O)N2CC3OC(C)(C)C[C@@H]3C2C(=O)C1 |
| InChI | InChI=1S/C32H49NO8/c1-21-14-12-10-8-6-7-9-11-13-15-23(30(40-22(2)34)25(35)16-17-28(37)39-5)18-26(36)29-24-19-32(3,4)41-27(24)20-33(29)31(21)38/h6-7,21,23-24,27,29-30H,8-20H2,1-5H3/t21-,23+,24-,27?,29?,30?/m0/s1 |
| InChIKey | KFFBKVRUZHJVJD-TZZSPJRUSA-N |
| XLogP | 4.74 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|