About ethylcyclopropane;5-ethyloxolan-2-one;methane
ethylcyclopropane;5-ethyloxolan-2-one;methane (PubChem CID 158681141) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is ethylcyclopropane;5-ethyloxolan-2-one;methane.
Molecular Properties
| Compound Name | ethylcyclopropane;5-ethyloxolan-2-one;methane |
| PubChem CID | 158681141 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | ethylcyclopropane;5-ethyloxolan-2-one;methane |
| SMILES | C.CCC1CC1.CCC1CCC(=O)O1 |
| InChI | InChI=1S/C6H10O2.C5H10.CH4/c1-2-5-3-4-6(7)8-5;1-2-5-3-4-5;/h5H,2-4H2,1H3;5H,2-4H2,1H3;1H4 |
| InChIKey | IFDJRWOQORFDCA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethylcyclopropane;5-ethyloxolan-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylcyclopropane;5-ethyloxolan-2-one;methane?
The IUPAC name of ethylcyclopropane;5-ethyloxolan-2-one;methane (CID 158681141) is ethylcyclopropane;5-ethyloxolan-2-one;methane.
What is the SMILES notation for ethylcyclopropane;5-ethyloxolan-2-one;methane?
The canonical SMILES for ethylcyclopropane;5-ethyloxolan-2-one;methane is C.CCC1CC1.CCC1CCC(=O)O1.
What is the InChIKey of ethylcyclopropane;5-ethyloxolan-2-one;methane?
The InChIKey is IFDJRWOQORFDCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C5H10.CH4/c1-2-5-3-4-6(7)8-5;1-2-5-3-4-5;/h5H,2-4H2,1H3;5H,2-4H2,1H3;1H4.
What are the key properties of ethylcyclopropane;5-ethyloxolan-2-one;methane?
ethylcyclopropane;5-ethyloxolan-2-one;methane has a molecular weight of 200.32 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylcyclopropane;5-ethyloxolan-2-one;methane is sourced from PubChem (CID 158681141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).