C25H29FN4O4 — CID 158682086
(14E)-8-fluoro-25-hydroxy-11,17-dimethyl-11,17,23,26-tetrazatetracyclo[16.7.2.05,10.023,27]heptacosa-1(25),5(10),6,8,14,26-hexaene-2,16,24-trione (PubChem CID 158682086) has the molecular formula C25H29FN4O4 and a molecular weight of 468.53 g/mol. Its IUPAC name is (14E)-8-fluoro-25-hydroxy-11,17-dimethyl-11,17,23,26-tetrazatetracyclo[16.7.2.05,10.023,27]heptacosa-1(25),5(10),6,8,14,26-hexaene-2,16,24-trione.
| Compound Name | (14E)-8-fluoro-25-hydroxy-11,17-dimethyl-11,17,23,26-tetrazatetracyclo[16.7.2.05,10.023,27]heptacosa-1(25),5(10),6,8,14,26-hexaene-2,16,24-trione |
|---|---|
| PubChem CID | 158682086 |
| Molecular Formula | C25H29FN4O4 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (14E)-8-fluoro-25-hydroxy-11,17-dimethyl-11,17,23,26-tetrazatetracyclo[16.7.2.05,10.023,27]heptacosa-1(25),5(10),6,8,14,26-hexaene-2,16,24-trione |
| SMILES | CN1CC/C=C\C(=O)N(C)C2CCCCn3c2nc(c(O)c3=O)C(=O)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C25H29FN4O4/c1-28-13-5-4-8-21(32)29(2)18-7-3-6-14-30-24(18)27-22(23(33)25(30)34)20(31)12-10-16-9-11-17(26)15-19(16)28/h4,8-9,11,15,18,33H,3,5-7,10,12-14H2,1-2H3/b8-4- |
| InChIKey | AGCZTPAFONDIIA-YWEYNIOJSA-N |
| XLogP | 2.98 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |