C32H23ClF6N6O2 — CID 158682232
N-[3-[[4-(6-chloro-3-pyridinyl)pyrimidin-2-yl]amino]-4-methylphenyl]-3-(trifluoromethyl)benzamide;3-(trifluoromethyl)benzamide (PubChem CID 158682232) has the molecular formula C32H23ClF6N6O2 and a molecular weight of 673.02 g/mol. Its IUPAC name is N-[3-[[4-(6-chloro-3-pyridinyl)pyrimidin-2-yl]amino]-4-methylphenyl]-3-(trifluoromethyl)benzamide;3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[[4-(6-chloro-3-pyridinyl)pyrimidin-2-yl]amino]-4-methylphenyl]-3-(trifluoromethyl)benzamide;3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 158682232 |
| Molecular Formula | C32H23ClF6N6O2 |
| Molecular Weight | 673.02 g/mol |
| Exact Mass | 672.15 |
| IUPAC Name | N-[3-[[4-(6-chloro-3-pyridinyl)pyrimidin-2-yl]amino]-4-methylphenyl]-3-(trifluoromethyl)benzamide;3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1Nc1nccc(-c2ccc(Cl)nc2)n1.NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17ClF3N5O.C8H6F3NO/c1-14-5-7-18(31-22(34)15-3-2-4-17(11-15)24(26,27)28)12-20(14)33-23-29-10-9-19(32-23)16-6-8-21(25)30-13-16;9-8(10,11)6-3-1-2-5(4-6)7(12)13/h2-13H,1H3,(H,31,34)(H,29,32,33);1-4H,(H2,12,13) |
| InChIKey | IFGXHCHVGCULHR-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.02 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|