C37H41N2O4+ — CID 158682544
3,3-dimethyl-14-oxa-10-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1,4,6,8,15,18,20-heptaen-17-one;1-[2-(1,3-dioxolan-2-yl)ethyl]-2,3,3-trimethylindol-1-ium (PubChem CID 158682544) has the molecular formula C37H41N2O4+ and a molecular weight of 577.75 g/mol. Its IUPAC name is 3,3-dimethyl-14-oxa-10-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1,4,6,8,15,18,20-heptaen-17-one;1-[2-(1,3-dioxolan-2-yl)ethyl]-2,3,3-trimethylindol-1-ium.
| Compound Name | 3,3-dimethyl-14-oxa-10-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1,4,6,8,15,18,20-heptaen-17-one;1-[2-(1,3-dioxolan-2-yl)ethyl]-2,3,3-trimethylindol-1-ium |
|---|---|
| PubChem CID | 158682544 |
| Molecular Formula | C37H41N2O4+ |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | 3,3-dimethyl-14-oxa-10-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1,4,6,8,15,18,20-heptaen-17-one;1-[2-(1,3-dioxolan-2-yl)ethyl]-2,3,3-trimethylindol-1-ium |
| SMILES | CC1(C)C2=C3C=C4C=CC(=O)C=C4OC3CCN2c2ccccc21.CC1=[N+](CCC2OCCO2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C21H19NO2.C16H22NO2/c1-21(2)16-5-3-4-6-17(16)22-10-9-18-15(20(21)22)11-13-7-8-14(23)12-19(13)24-18;1-12-16(2,3)13-6-4-5-7-14(13)17(12)9-8-15-18-10-11-19-15/h3-8,11-12,18H,9-10H2,1-2H3;4-7,15H,8-11H2,1-3H3/q;+1 |
| InChIKey | NVFXPLRJPHSMMC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 51.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|