About 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride
2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride (PubChem CID 158683397) has the molecular formula C11H15Cl2F2NOS
and a molecular weight of 318.22 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride |
| PubChem CID | 158683397 |
| Molecular Formula | C11H15Cl2F2NOS |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1ccsc1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H13F2NOS.2ClH/c12-11(13)4-1-7(2-5-11)9-8(10(14)15)3-6-16-9;;/h3,6-7H,1-2,4-5H2,(H2,14,15);2*1H |
| InChIKey | SBGJZHPGFUTTGK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride?
The IUPAC name of 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride (CID 158683397) is 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride.
What is the SMILES notation for 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride?
The canonical SMILES for 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride is Cl.Cl.NC(=O)c1ccsc1C1CCC(F)(F)CC1.
What is the InChIKey of 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride?
The InChIKey is SBGJZHPGFUTTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NOS.2ClH/c12-11(13)4-1-7(2-5-11)9-8(10(14)15)3-6-16-9;;/h3,6-7H,1-2,4-5H2,(H2,14,15);2*1H.
What are the key properties of 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride?
2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride has a molecular weight of 318.22 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexyl)thiophene-3-carboxamide;dihydrochloride is sourced from PubChem (CID 158683397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).