C16H30O5 — CID 158684652
carbonic acid;7-(2-methylbut-3-en-2-ylperoxy)-4-propylhept-3-ene (PubChem CID 158684652) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is carbonic acid;7-(2-methylbut-3-en-2-ylperoxy)-4-propylhept-3-ene.
| Compound Name | carbonic acid;7-(2-methylbut-3-en-2-ylperoxy)-4-propylhept-3-ene |
|---|---|
| PubChem CID | 158684652 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | carbonic acid;7-(2-methylbut-3-en-2-ylperoxy)-4-propylhept-3-ene |
| SMILES | C=CC(C)(C)OOCCCC(=CCC)CCC.O=C(O)O |
| InChI | InChI=1S/C15H28O2.CH2O3/c1-6-10-14(11-7-2)12-9-13-16-17-15(4,5)8-3;2-1(3)4/h8,10H,3,6-7,9,11-13H2,1-2,4-5H3;(H2,2,3,4) |
| InChIKey | IFOQHTCHJUGVSE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|