About methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone
methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone (PubChem CID 158684864) has the molecular formula C19H22O2S2
and a molecular weight of 346.52 g/mol. Its IUPAC name is methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone.
Molecular Properties
| Compound Name | methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone |
| PubChem CID | 158684864 |
| Molecular Formula | C19H22O2S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone |
| SMILES | CC(=O)c1cccs1.COCc1ccccc1.Cc1cccs1 |
| InChI | InChI=1S/C8H10O.C6H6OS.C5H6S/c1-9-7-8-5-3-2-4-6-8;1-5(7)6-3-2-4-8-6;1-5-3-2-4-6-5/h2-6H,7H2,1H3;2-4H,1H3;2-4H,1H3 |
| InChIKey | IFPLAJRISKZOGD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone?
The IUPAC name of methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone (CID 158684864) is methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone.
What is the SMILES notation for methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone?
The canonical SMILES for methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone is CC(=O)c1cccs1.COCc1ccccc1.Cc1cccs1.
What is the InChIKey of methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone?
The InChIKey is IFPLAJRISKZOGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C6H6OS.C5H6S/c1-9-7-8-5-3-2-4-6-8;1-5(7)6-3-2-4-8-6;1-5-3-2-4-6-5/h2-6H,7H2,1H3;2-4H,1H3;2-4H,1H3.
What are the key properties of methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone?
methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone has a molecular weight of 346.52 g/mol, XLogP of 5.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethylbenzene;2-methylthiophene;1-thiophen-2-ylethanone is sourced from PubChem (CID 158684864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).