About [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate
[(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate (PubChem CID 158685216) has the molecular formula C20H19N3O2
and a molecular weight of 333.39 g/mol. Its IUPAC name is [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate.
Molecular Properties
| Compound Name | [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate |
| PubChem CID | 158685216 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate |
| SMILES | O=C(Nc1cccc2cnccc12)O[C@@H]1CNC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19N3O2/c24-20(23-18-8-4-7-15-11-21-10-9-16(15)18)25-19-13-22-12-17(19)14-5-2-1-3-6-14/h1-11,17,19,22H,12-13H2,(H,23,24)/t17-,19+/m0/s1 |
| InChIKey | CZNBITCFRLGLFQ-PKOBYXMFSA-N |
| XLogP | 3.54 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate?
The IUPAC name of [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate (CID 158685216) is [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate.
What is the SMILES notation for [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate?
The canonical SMILES for [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate is O=C(Nc1cccc2cnccc12)O[C@@H]1CNC[C@H]1c1ccccc1.
What is the InChIKey of [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate?
The InChIKey is CZNBITCFRLGLFQ-PKOBYXMFSA-N. The full InChI is InChI=1S/C20H19N3O2/c24-20(23-18-8-4-7-15-11-21-10-9-16(15)18)25-19-13-22-12-17(19)14-5-2-1-3-6-14/h1-11,17,19,22H,12-13H2,(H,23,24)/t17-,19+/m0/s1.
What are the key properties of [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate?
[(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate has a molecular weight of 333.39 g/mol, XLogP of 3.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-phenylpyrrolidin-3-yl] N-isoquinolin-5-ylcarbamate is sourced from PubChem (CID 158685216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).