C10H17O3P — CID 158685668
dimethyl hydrogen phosphite;1,2-dimethyl-5-methylidenecyclopenta-1,3-diene (PubChem CID 158685668) has the molecular formula C10H17O3P and a molecular weight of 216.22 g/mol. Its IUPAC name is dimethyl hydrogen phosphite;1,2-dimethyl-5-methylidenecyclopenta-1,3-diene.
| Compound Name | dimethyl hydrogen phosphite;1,2-dimethyl-5-methylidenecyclopenta-1,3-diene |
|---|---|
| PubChem CID | 158685668 |
| Molecular Formula | C10H17O3P |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | dimethyl hydrogen phosphite;1,2-dimethyl-5-methylidenecyclopenta-1,3-diene |
| SMILES | C=C1C=CC(C)=C1C.COP(O)OC |
| InChI | InChI=1S/C8H10.C2H7O3P/c1-6-4-5-7(2)8(6)3;1-4-6(3)5-2/h4-5H,1H2,2-3H3;3H,1-2H3 |
| InChIKey | IFRXKWZJZXUFRW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|