About CID 158686785
CID 158686785 (PubChem CID 158686785) has the molecular formula C32H29BCl3F6N8O4
and a molecular weight of 820.79 g/mol.
Molecular Properties
| Compound Name | CID 158686785 |
| PubChem CID | 158686785 |
| Molecular Formula | C32H29BCl3F6N8O4 |
| Molecular Weight | 820.79 g/mol |
| Exact Mass | 819.14 |
| IUPAC Name | — |
| SMILES | COc1ncc(C(F)(F)F)cc1-c1nc2c(cc1Cl)N1CC[C@@H](C1)N2.COc1ncc(C(F)(F)F)cc1O[B]O.Clc1cc2c(nc1Cl)N[C@H]1CCN2C1 |
| InChI | InChI=1S/C16H14ClF3N4O.C9H9Cl2N3.C7H6BF3NO3/c1-25-15-10(4-8(6-21-15)16(18,19)20)13-11(17)5-12-14(23-13)22-9-2-3-24(12)7-9;10-6-3-7-9(13-8(6)11)12-5-1-2-14(7)4-5;1-14-6-5(15-8-13)2-4(3-12-6)7(9,10)11/h4-6,9H,2-3,7H2,1H3,(H,22,23);3,5H,1-2,4H2,(H,12,13);2-3,13H,1H3/t9-;5-;/m00./s1 |
| InChIKey | UZQWJXHANDPQEW-VZSHSMSCSA-N |
| XLogP | 7.24 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 820.79 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158686785 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158686785?
The IUPAC name of CID 158686785 (CID 158686785) is not available.
What is the SMILES notation for CID 158686785?
The canonical SMILES for CID 158686785 is COc1ncc(C(F)(F)F)cc1-c1nc2c(cc1Cl)N1CC[C@@H](C1)N2.COc1ncc(C(F)(F)F)cc1O[B]O.Clc1cc2c(nc1Cl)N[C@H]1CCN2C1.
What is the InChIKey of CID 158686785?
The InChIKey is UZQWJXHANDPQEW-VZSHSMSCSA-N. The full InChI is InChI=1S/C16H14ClF3N4O.C9H9Cl2N3.C7H6BF3NO3/c1-25-15-10(4-8(6-21-15)16(18,19)20)13-11(17)5-12-14(23-13)22-9-2-3-24(12)7-9;10-6-3-7-9(13-8(6)11)12-5-1-2-14(7)4-5;1-14-6-5(15-8-13)2-4(3-12-6)7(9,10)11/h4-6,9H,2-3,7H2,1H3,(H,22,23);3,5H,1-2,4H2,(H,12,13);2-3,13H,1H3/t9-;5-;/m00./s1.
What are the key properties of CID 158686785?
CID 158686785 has a molecular weight of 820.79 g/mol, XLogP of 7.24, 5 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158686785 is sourced from PubChem (CID 158686785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).