About 3,3-dioxobenzo[e][1,2]benzodithiol-1-one
3,3-dioxobenzo[e][1,2]benzodithiol-1-one (PubChem CID 15868679) has the molecular formula C11H6O3S2
and a molecular weight of 250.30 g/mol. Its IUPAC name is 3,3-dioxobenzo[e][1,2]benzodithiol-1-one.
Molecular Properties
| Compound Name | 3,3-dioxobenzo[e][1,2]benzodithiol-1-one |
| PubChem CID | 15868679 |
| Molecular Formula | C11H6O3S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 3,3-dioxobenzo[e][1,2]benzodithiol-1-one |
| SMILES | O=C1SS(=O)(=O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C11H6O3S2/c12-11-10-8-4-2-1-3-7(8)5-6-9(10)16(13,14)15-11/h1-6H |
| InChIKey | HFNCSGKXDLMPCY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dioxobenzo[e][1,2]benzodithiol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dioxobenzo[e][1,2]benzodithiol-1-one?
The IUPAC name of 3,3-dioxobenzo[e][1,2]benzodithiol-1-one (CID 15868679) is 3,3-dioxobenzo[e][1,2]benzodithiol-1-one.
What is the SMILES notation for 3,3-dioxobenzo[e][1,2]benzodithiol-1-one?
The canonical SMILES for 3,3-dioxobenzo[e][1,2]benzodithiol-1-one is O=C1SS(=O)(=O)c2ccc3ccccc3c21.
What is the InChIKey of 3,3-dioxobenzo[e][1,2]benzodithiol-1-one?
The InChIKey is HFNCSGKXDLMPCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6O3S2/c12-11-10-8-4-2-1-3-7(8)5-6-9(10)16(13,14)15-11/h1-6H.
What are the key properties of 3,3-dioxobenzo[e][1,2]benzodithiol-1-one?
3,3-dioxobenzo[e][1,2]benzodithiol-1-one has a molecular weight of 250.30 g/mol, XLogP of 2.42, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dioxobenzo[e][1,2]benzodithiol-1-one is sourced from PubChem (CID 15868679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).