C24H31IN4O3Si — CID 158686828
1-[3-acetyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]-2-(4-isocyanophenyl)ethanone (PubChem CID 158686828) has the molecular formula C24H31IN4O3Si and a molecular weight of 578.53 g/mol. Its IUPAC name is 1-[3-acetyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]-2-(4-isocyanophenyl)ethanone.
| Compound Name | 1-[3-acetyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]-2-(4-isocyanophenyl)ethanone |
|---|---|
| PubChem CID | 158686828 |
| Molecular Formula | C24H31IN4O3Si |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | 1-[3-acetyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]-2-(4-isocyanophenyl)ethanone |
| SMILES | [C-]#[N+]c1ccc(CC(=O)N2Cc3c(C(C)=O)c(I)nn3CC2CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H31IN4O3Si/c1-16(30)22-20-14-28(21(31)12-17-8-10-18(26-5)11-9-17)19(13-29(20)27-23(22)25)15-32-33(6,7)24(2,3)4/h8-11,19H,12-15H2,1-4,6-7H3 |
| InChIKey | PZXNYYADYZHJHQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 68.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|