C10H16N4O — CID 158687457
(1S,2S,4R)-2-ethyl-4-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol (PubChem CID 158687457) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is (1S,2S,4R)-2-ethyl-4-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol.
| Compound Name | (1S,2S,4R)-2-ethyl-4-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 158687457 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (1S,2S,4R)-2-ethyl-4-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol |
| SMILES | CC[C@H]1C[C@@H](Nc2ncncn2)C[C@@H]1O |
| InChI | InChI=1S/C10H16N4O/c1-2-7-3-8(4-9(7)15)14-10-12-5-11-6-13-10/h5-9,15H,2-4H2,1H3,(H,11,12,13,14)/t7-,8+,9-/m0/s1 |
| InChIKey | NNLQUKDIOOSHSD-YIZRAAEISA-N |
| XLogP | 0.83 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |