About ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one
ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one (PubChem CID 158688713) has the molecular formula C28H32N2O5
and a molecular weight of 476.57 g/mol. Its IUPAC name is ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one.
Molecular Properties
| Compound Name | ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one |
| PubChem CID | 158688713 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one |
| SMILES | CC(=O)Cc1ccccc1.CCOC(=O)/C(C#N)=C(\C)Cc1ccccc1.CCOC(=O)CC#N |
| InChI | InChI=1S/C14H15NO2.C9H10O.C5H7NO2/c1-3-17-14(16)13(10-15)11(2)9-12-7-5-4-6-8-12;1-8(10)7-9-5-3-2-4-6-9;1-2-8-5(7)3-4-6/h4-8H,3,9H2,1-2H3;2-6H,7H2,1H3;2-3H2,1H3/b13-11+;; |
| InChIKey | IGBKJFJKNLSLBD-UAIOKUCGSA-N |
| XLogP | 4.91 |
| TPSA | 117.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one?
The IUPAC name of ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one (CID 158688713) is ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one.
What is the SMILES notation for ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one?
The canonical SMILES for ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one is CC(=O)Cc1ccccc1.CCOC(=O)/C(C#N)=C(\C)Cc1ccccc1.CCOC(=O)CC#N.
What is the InChIKey of ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one?
The InChIKey is IGBKJFJKNLSLBD-UAIOKUCGSA-N. The full InChI is InChI=1S/C14H15NO2.C9H10O.C5H7NO2/c1-3-17-14(16)13(10-15)11(2)9-12-7-5-4-6-8-12;1-8(10)7-9-5-3-2-4-6-9;1-2-8-5(7)3-4-6/h4-8H,3,9H2,1-2H3;2-6H,7H2,1H3;2-3H2,1H3/b13-11+;;.
What are the key properties of ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one?
ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one has a molecular weight of 476.57 g/mol, XLogP of 4.91, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyanoacetate;ethyl (E)-2-cyano-3-methyl-4-phenylbut-2-enoate;1-phenylpropan-2-one is sourced from PubChem (CID 158688713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).